CAS 68341-14-0 appears in our catalog under these names: Cu(II)GTSM, 98%, Cu(II)GTSM, Cu–GTSM, Cu(II)GTSM 98%, Cu-GTSM. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 1mg, 10mg, 25mg, 50mg, 100mg, 25 mg.
Copper;N-methyl-N'-[2-[[methylamino(sulfido)methylidene]hydrazinylidene]ethylideneamino]carbamimidothioate (CAS 68341-14-0) is a chemical compound with the molecular formula C6H10CuN6S2-2 and a molecular weight of 293.9 g/mol. IUPAC name: copper;N-methyl-N'-[2-[[methylamino(sulfido)methylidene]hydrazinylidene]ethylideneamino]carbamimidothioate. InChIKey: MNLAJDKBIQOELG-UHFFFAOYSA-L.
| Molecular formula | C6H10CuN6S2-2 |
|---|---|
| Molecular weight | 293.9 g/mol |
| IUPAC name | copper;N-methyl-N'-[2-[[methylamino(sulfido)methylidene]hydrazinylidene]ethylideneamino]carbamimidothioate |
| InChIKey | MNLAJDKBIQOELG-UHFFFAOYSA-L |
| SMILES | CNC(=NN=CC=NN=C(NC)[S-])[S-].[Cu] |
Computed by PubChem (NCBI)