CAS 68354-47-2 appears in our catalog under these names: (3S)-2,5,5-Trimethylpyrrolidine-3-carboxylic acid-1-oxyl, 98%, (-)-3-Carboxy-2,2,5,5-tetramethylpyrrolidinyl-1-oxy. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 2mg, 5mg.
(3S)-2,2,5,5-tetramethyl-1-oxidopyrrolidine-3-carboxylic acid (CAS 68354-47-2) is a chemical compound with the molecular formula C9H16NO3- and a molecular weight of 186.23 g/mol. IUPAC name: (3S)-2,2,5,5-tetramethyl-1-oxidopyrrolidine-3-carboxylic acid. InChIKey: YYQRDQMYBZUAMT-ZCFIWIBFSA-N.
| Molecular formula | C9H16NO3- |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | (3S)-2,2,5,5-tetramethyl-1-oxidopyrrolidine-3-carboxylic acid |
| InChIKey | YYQRDQMYBZUAMT-ZCFIWIBFSA-N |
| SMILES | CC1(C[C@@H](C(N1[O-])(C)C)C(=O)O)C |
Computed by PubChem (NCBI)