Products 68357-16-4
CAS 68357-16-4 is the registry number for 2'-F-ADP. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (CAS 68357-16-4) is a chemical compound with the molecular formula C10H14FN5O9P2 and a molecular weight of 429.19 g/mol. IUPAC name: [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate. InChIKey: SYZPLSDXCWMVQL-QYYRPYCUSA-N.
| Molecular formula | C10H14FN5O9P2 |
|---|---|
| Molecular weight | 429.19 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| InChIKey | SYZPLSDXCWMVQL-QYYRPYCUSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)O)O)F)N |
Computed by PubChem (NCBI)