CAS 68385-26-2 appears in our catalog under these names: Tos-gly-osu, 98%, Tos–Gly–OSu, Tos-Gly-OSu, 2,5-Dioxopyrrolidin-1-yl tosylglycinate 97%, Tos-Gly-OSu, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 5g, 25g, 1g.
(2,5-dioxopyrrolidin-1-yl) 2-[(4-methylphenyl)sulfonylamino]acetate (CAS 68385-26-2) is a chemical compound with the molecular formula C13H14N2O6S and a molecular weight of 326.33 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-[(4-methylphenyl)sulfonylamino]acetate. InChIKey: NTDCTADMSAKZGL-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O6S |
|---|---|
| Molecular weight | 326.33 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-[(4-methylphenyl)sulfonylamino]acetate |
| InChIKey | NTDCTADMSAKZGL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)