Products 68385-96-6
CAS 68385-96-6 is the registry number for Disperse Red 343. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-[(2,6-dicyano-4-methylphenyl)diazenyl]-5-(diethylamino)phenyl]methanesulfonamide (CAS 68385-96-6) is a chemical compound with the molecular formula C20H22N6O2S and a molecular weight of 410.5 g/mol. IUPAC name: N-[2-[(2,6-dicyano-4-methylphenyl)diazenyl]-5-(diethylamino)phenyl]methanesulfonamide. InChIKey: NSLHLMXJNOITEZ-UHFFFAOYSA-N.
| Molecular formula | C20H22N6O2S |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | N-[2-[(2,6-dicyano-4-methylphenyl)diazenyl]-5-(diethylamino)phenyl]methanesulfonamide |
| InChIKey | NSLHLMXJNOITEZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)N=NC2=C(C=C(C=C2C#N)C)C#N)NS(=O)(=O)C |
Computed by PubChem (NCBI)