Products 68388-91-0
CAS 68388-91-0 appears in our catalog under these names: Adpoc–Trp–OH, Adpoc-L-Trp-OH. Offered by: GLPBio, Iris Biotech. Available pack sizes: 1g, 5g, 25g.
(2S)-2-[[1-(1-adamantyl)-2-methylpropan-2-yl]oxycarbonylamino]-3-(1H-indol-3-yl)propanoic acid (CAS 68388-91-0) is a chemical compound with the molecular formula C26H34N2O4 and a molecular weight of 438.6 g/mol. IUPAC name: (2S)-2-[[1-(1-adamantyl)-2-methylpropan-2-yl]oxycarbonylamino]-3-(1H-indol-3-yl)propanoic acid. InChIKey: WCCIXRYSJDUEOF-ZYTNRUGMSA-N.
| Molecular formula | C26H34N2O4 |
|---|---|
| Molecular weight | 438.6 g/mol |
| IUPAC name | (2S)-2-[[1-(1-adamantyl)-2-methylpropan-2-yl]oxycarbonylamino]-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | WCCIXRYSJDUEOF-ZYTNRUGMSA-N |
| SMILES | CC(C)(CC12CC3CC(C1)CC(C3)C2)OC(=O)N[C@@H](CC4=CNC5=CC=CC=C54)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Adpoc-Trp-OH, Adpoc-L-Trp-OH