CAS 684-29-7 is the registry number for 1,1,1,3,3,3-Hexafluoro-2-isocyanatopropane. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1,1,3,3,3-hexafluoro-2-isocyanatopropane (CAS 684-29-7) is a chemical compound with the molecular formula C4HF6NO and a molecular weight of 193.05 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoro-2-isocyanatopropane. InChIKey: LMANEPOTDUUVCO-UHFFFAOYSA-N.
| Molecular formula | C4HF6NO |
|---|---|
| Molecular weight | 193.05 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoro-2-isocyanatopropane |
| InChIKey | LMANEPOTDUUVCO-UHFFFAOYSA-N |
| SMILES | C(=NC(C(F)(F)F)C(F)(F)F)=O |
Computed by PubChem (NCBI)