CAS 684-31-1 appears in our catalog under these names: Methoxy(2,2,2-trichloro-1-hydroxyethyl)phosphinic acid, Methyl hydrogen (2,2,2-trichloro-1-hydroxyethyl)phosphonate, 95+%, Methyl (RS)-(2,2,2-Trichloro-1-hydroxyethyl)phosphonate Acid (Desmethylmetrifonate). Offered by: Biosynth, AmBeed, Mikromol. Available pack sizes: 0,5g, 50mg, 1g, 25mg.
Methoxy-(2,2,2-trichloro-1-hydroxyethyl)phosphinic acid (CAS 684-31-1) is a chemical compound with the molecular formula C3H6Cl3O4P and a molecular weight of 243.41 g/mol. IUPAC name: methoxy-(2,2,2-trichloro-1-hydroxyethyl)phosphinic acid. InChIKey: KFPHBRHXSUAGID-UHFFFAOYSA-N.
| Molecular formula | C3H6Cl3O4P |
|---|---|
| Molecular weight | 243.41 g/mol |
| IUPAC name | methoxy-(2,2,2-trichloro-1-hydroxyethyl)phosphinic acid |
| InChIKey | KFPHBRHXSUAGID-UHFFFAOYSA-N |
| SMILES | COP(=O)(C(C(Cl)(Cl)Cl)O)O |
Computed by PubChem (NCBI)