CAS 6840-28-4 is the registry number for Phosphine oxide, (4-methylphenyl)diphenyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
1-diphenylphosphoryl-4-methylbenzene (CAS 6840-28-4) is a chemical compound with the molecular formula C19H17OP and a molecular weight of 292.3 g/mol. IUPAC name: 1-diphenylphosphoryl-4-methylbenzene. InChIKey: FSTTVKGSJLFJAC-UHFFFAOYSA-N.
| Molecular formula | C19H17OP |
|---|---|
| Molecular weight | 292.3 g/mol |
| IUPAC name | 1-diphenylphosphoryl-4-methylbenzene |
| InChIKey | FSTTVKGSJLFJAC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)P(=O)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)