CAS 68401-60-5 is the registry number for (Z)-2-((2-Ethoxy-2-oxoethoxy)imino)-2-(2-formamidothiazol-4-yl)acetic Acid. Offered by: TRC. Available pack sizes: 100mg, 10mg, 25mg.
(2Z)-2-(2-ethoxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid (CAS 68401-60-5) is a chemical compound with the molecular formula C10H11N3O6S and a molecular weight of 301.28 g/mol. IUPAC name: (2Z)-2-(2-ethoxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid. InChIKey: VZRKYOWOWILIHD-JYRVWZFOSA-N.
| Molecular formula | C10H11N3O6S |
|---|---|
| Molecular weight | 301.28 g/mol |
| IUPAC name | (2Z)-2-(2-ethoxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetic acid |
| InChIKey | VZRKYOWOWILIHD-JYRVWZFOSA-N |
| SMILES | CCOC(=O)CO/N=C(/C1=CSC(=N1)NC=O)\C(=O)O |
Computed by PubChem (NCBI)