CAS 68408-25-3 appears in our catalog under these names: 3–AMINO–(METHYLBENZENE–D7), m-Toluidine-d7 (NH2), 98 atom % D, min 98% Chemical Purity. Offered by: GLPBio, CDN. Available pack sizes: 25mg, 1g, 0,5g.
2,3,4,6-tetradeuterio-5-(trideuteriomethyl)aniline (CAS 68408-25-3) is a chemical compound with the molecular formula C7H9N and a molecular weight of 114.20 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-(trideuteriomethyl)aniline. InChIKey: JJYPMNFTHPTTDI-AAYPNNLASA-N.
| Molecular formula | C7H9N |
|---|---|
| Molecular weight | 114.20 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-(trideuteriomethyl)aniline |
| InChIKey | JJYPMNFTHPTTDI-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])N)[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)