CAS 6843-66-9 appears in our catalog under these names: Dimethoxydiphenylsilane, Dimethoxydiphenylsilane, 97% , Dimethoxydiphenylsilane, >98.0%(GC), Dimethoxydiphenylsilane 98%, DIMETHOXYDIPHENYLSILANE, >=95.0%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 2,5l, 500ml, 1000g, 50g, 250g, 25ml, 100ml, 25g.
Dimethoxy(diphenyl)silane (CAS 6843-66-9) is a chemical compound with the molecular formula C14H16O2Si and a molecular weight of 244.36 g/mol. IUPAC name: dimethoxy(diphenyl)silane. InChIKey: AHUXYBVKTIBBJW-UHFFFAOYSA-N.
| Molecular formula | C14H16O2Si |
|---|---|
| Molecular weight | 244.36 g/mol |
| IUPAC name | dimethoxy(diphenyl)silane |
| InChIKey | AHUXYBVKTIBBJW-UHFFFAOYSA-N |
| SMILES | CO[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)