Products 6843-76-1
CAS 6843-76-1 appears in our catalog under these names: 1,6-Hexane-1,1,6,6-d4-diol, 1,6-Hexane-1,1,6,6-d4-diol, 98 atom % D, min 98% Chemical Purity, Hexane-1,6-diol-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 1 mg, 10 mg, 5 mg.
1,1,6,6-tetradeuteriohexane-1,6-diol (CAS 6843-76-1) is a chemical compound with the molecular formula C6H14O2 and a molecular weight of 122.20 g/mol. IUPAC name: 1,1,6,6-tetradeuteriohexane-1,6-diol. InChIKey: XXMIOPMDWAUFGU-NZLXMSDQSA-N.
| Molecular formula | C6H14O2 |
|---|---|
| Molecular weight | 122.20 g/mol |
| IUPAC name | 1,1,6,6-tetradeuteriohexane-1,6-diol |
| InChIKey | XXMIOPMDWAUFGU-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(CCCCC([2H])([2H])O)O |
Computed by PubChem (NCBI)