CAS 68460-01-5 appears in our catalog under these names: Tetrabromo-2-sulfobenzoic acid cyclic anhydride, 95%, 4,5,6,7-Tetrabromo-3H-benzo[c][1,2]oxathiol-3-one 1,1-dioxide, 98%, Tetrabromo-o-sulfobenzoic Anhydride, >98.0%(GC), Tetrabromo-o-sulfobenzoic anhydride. Offered by: Combi-blocks, Chemat Brand, TCI, MedChemExpress. Available pack sizes: 25g, 1g, 5g, on request, Get quote.
4,5,6,7-tetrabromo-1,1-dioxo-2,1lambda6-benzoxathiol-3-one (CAS 68460-01-5) is a chemical compound with the molecular formula C7Br4O4S and a molecular weight of 499.76 g/mol. IUPAC name: 4,5,6,7-tetrabromo-1,1-dioxo-2,1lambda6-benzoxathiol-3-one. InChIKey: QPGYGIVRJIICGZ-UHFFFAOYSA-N.
| Molecular formula | C7Br4O4S |
|---|---|
| Molecular weight | 499.76 g/mol |
| IUPAC name | 4,5,6,7-tetrabromo-1,1-dioxo-2,1lambda6-benzoxathiol-3-one |
| InChIKey | QPGYGIVRJIICGZ-UHFFFAOYSA-N |
| SMILES | C12=C(C(=C(C(=C1Br)Br)Br)Br)S(=O)(=O)OC2=O |
Computed by PubChem (NCBI)