CAS 684648-47-3 appears in our catalog under these names: 2-(3,5-Difluorophenyl)-1,3,2-dioxaborinane, 95%, 2-(3,5-Difluorophenyl)-1,3,2-dioxaborinane 98%, 2-(3,5-Difluorophenyl)-1,3,2-dioxaborinane. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 250mg.
2-(3,5-difluorophenyl)-1,3,2-dioxaborinane (CAS 684648-47-3) is a chemical compound with the molecular formula C9H9BF2O2 and a molecular weight of 197.98 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-1,3,2-dioxaborinane. InChIKey: OPMWYZCBZAQSRG-UHFFFAOYSA-N.
| Molecular formula | C9H9BF2O2 |
|---|---|
| Molecular weight | 197.98 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-1,3,2-dioxaborinane |
| InChIKey | OPMWYZCBZAQSRG-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)