CAS 68469-71-6 is the registry number for 2,2'-(Phenylphosphanediyl)dipyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
Phenyl(dipyridin-2-yl)phosphane (CAS 68469-71-6) is a chemical compound with the molecular formula C16H13N2P and a molecular weight of 264.26 g/mol. IUPAC name: phenyl(dipyridin-2-yl)phosphane. InChIKey: MHYHLTYYPLBVPL-UHFFFAOYSA-N.
| Molecular formula | C16H13N2P |
|---|---|
| Molecular weight | 264.26 g/mol |
| IUPAC name | phenyl(dipyridin-2-yl)phosphane |
| InChIKey | MHYHLTYYPLBVPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)