CAS 685-24-5 appears in our catalog under these names: 1,1,1,4,4,4-Hexafluorobutan-2,3-dione, 1,1,1,7,7,7-Hexafluoroheptane-2,4,6-trione. Offered by: Chemat. Available pack sizes: 5g, 2,5g.
1,1,1,4,4,4-hexafluorobutane-2,3-dione (CAS 685-24-5) is a chemical compound with the molecular formula C4F6O2 and a molecular weight of 194.03 g/mol. IUPAC name: 1,1,1,4,4,4-hexafluorobutane-2,3-dione. InChIKey: ZMIDKLPSOSQFSX-UHFFFAOYSA-N.
| Molecular formula | C4F6O2 |
|---|---|
| Molecular weight | 194.03 g/mol |
| IUPAC name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| InChIKey | ZMIDKLPSOSQFSX-UHFFFAOYSA-N |
| SMILES | C(=O)(C(=O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)