CAS 68508-18-9 appears in our catalog under these names: Triclosan O-Sulfate Sodium Salt, 5-Chloro-2-(2,4-dichlorophenoxy)phenyl hydrogen sulfate sodium. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 25mg.
Sodium [5-chloro-2-(2,4-dichlorophenoxy)phenyl] sulfate (CAS 68508-18-9) is a chemical compound with the molecular formula C12H6Cl3NaO5S and a molecular weight of 391.6 g/mol. IUPAC name: sodium [5-chloro-2-(2,4-dichlorophenoxy)phenyl] sulfate. InChIKey: RIOAPGGJJKGTHL-UHFFFAOYSA-M.
| Molecular formula | C12H6Cl3NaO5S |
|---|---|
| Molecular weight | 391.6 g/mol |
| IUPAC name | sodium [5-chloro-2-(2,4-dichlorophenoxy)phenyl] sulfate |
| InChIKey | RIOAPGGJJKGTHL-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1Cl)OS(=O)(=O)[O-])OC2=C(C=C(C=C2)Cl)Cl.[Na+] |
Computed by PubChem (NCBI)