CAS 685114-93-6 is the registry number for N-Benzylthieno[3,2-b]thiophene-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzylthieno[3,2-b]thiophene-5-carboxamide (CAS 685114-93-6) is a chemical compound with the molecular formula C14H11NOS2 and a molecular weight of 273.4 g/mol. IUPAC name: N-benzylthieno[3,2-b]thiophene-5-carboxamide. InChIKey: UOUXYTDNAVQXNV-UHFFFAOYSA-N.
| Molecular formula | C14H11NOS2 |
|---|---|
| Molecular weight | 273.4 g/mol |
| IUPAC name | N-benzylthieno[3,2-b]thiophene-5-carboxamide |
| InChIKey | UOUXYTDNAVQXNV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC3=C(S2)C=CS3 |
Computed by PubChem (NCBI)