Products 685123-50-6
CAS 685123-50-6 is the registry number for RF03176. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(1,2,3-benzothiadiazol-6-yl)-3-phenylurea (CAS 685123-50-6) is a chemical compound with the molecular formula C13H10N4OS and a molecular weight of 270.31 g/mol. IUPAC name: 1-(1,2,3-benzothiadiazol-6-yl)-3-phenylurea. InChIKey: UENZGSOUYQOBAA-UHFFFAOYSA-N.
| Molecular formula | C13H10N4OS |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 1-(1,2,3-benzothiadiazol-6-yl)-3-phenylurea |
| InChIKey | UENZGSOUYQOBAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)NC2=CC3=C(C=C2)N=NS3 |
Computed by PubChem (NCBI)