CAS 68549-76-8 is the registry number for 1-Bromo-4-(4-(tert-butyl)phenoxy)benzene, 97%. Offered by: AmBeed. Available pack sizes: 5g.
1-bromo-4-(4-tert-butylphenoxy)benzene (CAS 68549-76-8) is a chemical compound with the molecular formula C16H17BrO and a molecular weight of 305.21 g/mol. IUPAC name: 1-bromo-4-(4-tert-butylphenoxy)benzene. InChIKey: JKJAXUZDFRSBML-UHFFFAOYSA-N.
| Molecular formula | C16H17BrO |
|---|---|
| Molecular weight | 305.21 g/mol |
| IUPAC name | 1-bromo-4-(4-tert-butylphenoxy)benzene |
| InChIKey | JKJAXUZDFRSBML-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)