CAS 685503-45-1 is the registry number for 1-[3,5-Bis(trifluoromethyl)phenyl]propylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[3,5-bis(trifluoromethyl)phenyl]propan-1-amine (CAS 685503-45-1) is a chemical compound with the molecular formula C11H11F6N and a molecular weight of 271.20 g/mol. IUPAC name: 1-[3,5-bis(trifluoromethyl)phenyl]propan-1-amine. InChIKey: JDBPNFXZESJTAH-UHFFFAOYSA-N.
| Molecular formula | C11H11F6N |
|---|---|
| Molecular weight | 271.20 g/mol |
| IUPAC name | 1-[3,5-bis(trifluoromethyl)phenyl]propan-1-amine |
| InChIKey | JDBPNFXZESJTAH-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)N |
Computed by PubChem (NCBI)