CAS 685513-94-4 is the registry number for 4-Chloro-5-fluoro-1-(triisopropylsilyl)-1h-pyrrolo[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4-chloro-5-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane (CAS 685513-94-4) is a chemical compound with the molecular formula C16H24ClFN2Si and a molecular weight of 326.91 g/mol. IUPAC name: (4-chloro-5-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane. InChIKey: FMYVOYPAUVIMAU-UHFFFAOYSA-N.
| Molecular formula | C16H24ClFN2Si |
|---|---|
| Molecular weight | 326.91 g/mol |
| IUPAC name | (4-chloro-5-fluoropyrrolo[2,3-b]pyridin-1-yl)-tri(propan-2-yl)silane |
| InChIKey | FMYVOYPAUVIMAU-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=C(C(=CN=C21)F)Cl |
Computed by PubChem (NCBI)