CAS 6856-31-1 appears in our catalog under these names: Pridinol methanesulfonate salt, 97%, Pridinol Methanesulfonate, Pridinol Methanesulfonate Salt, >95% (HPLC), Pridinol Mesilate, Loxeen/ 99.72% (existing batch purity). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, TargetMol. Available pack sizes: 1g, 250mg, 5g, on request, 100mg, 25mg, 50mg, 500mg.
1,1-diphenyl-3-piperidin-1-ylpropan-1-ol;methanesulfonic acid (CAS 6856-31-1) is a chemical compound with the molecular formula C21H29NO4S and a molecular weight of 391.5 g/mol. IUPAC name: 1,1-diphenyl-3-piperidin-1-ylpropan-1-ol;methanesulfonic acid. InChIKey: VNJHUUNVDMYCRH-UHFFFAOYSA-N.
| Molecular formula | C21H29NO4S |
|---|---|
| Molecular weight | 391.5 g/mol |
| IUPAC name | 1,1-diphenyl-3-piperidin-1-ylpropan-1-ol;methanesulfonic acid |
| InChIKey | VNJHUUNVDMYCRH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1CCN(CC1)CCC(C2=CC=CC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)