CAS 685830-90-4 is the registry number for MAC 1753. Offered by: TRC. Available pack sizes: 100mg.
5-(3,5-dichlorophenoxy)-N-pyridin-4-ylfuran-2-carboxamide (CAS 685830-90-4) is a chemical compound with the molecular formula C16H10Cl2N2O3 and a molecular weight of 349.2 g/mol. IUPAC name: 5-(3,5-dichlorophenoxy)-N-pyridin-4-ylfuran-2-carboxamide. InChIKey: FRDJJGSXDLUKPF-UHFFFAOYSA-N.
| Molecular formula | C16H10Cl2N2O3 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | 5-(3,5-dichlorophenoxy)-N-pyridin-4-ylfuran-2-carboxamide |
| InChIKey | FRDJJGSXDLUKPF-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1NC(=O)C2=CC=C(O2)OC3=CC(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)