CAS 685850-87-7 is the registry number for Nadolol Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
(6S,7R)-5,6,7,8-tetrahydronaphthalene-1,6,7-triol (CAS 685850-87-7) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: (6S,7R)-5,6,7,8-tetrahydronaphthalene-1,6,7-triol. InChIKey: AUKZSCHMOAPNEN-VHSXEESVSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | (6S,7R)-5,6,7,8-tetrahydronaphthalene-1,6,7-triol |
| InChIKey | AUKZSCHMOAPNEN-VHSXEESVSA-N |
| SMILES | C1[C@@H]([C@@H](CC2=C1C=CC=C2O)O)O |
Computed by PubChem (NCBI)