CAS 685853-98-9 appears in our catalog under these names: 2-(4-Methylpiperazin-1-yl)-5-(trifluoromethyl)aniline, 98%, 2-(4-Methylpiperazin-1-yl)-5-(trifluoromethyl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 10g, 5g, 0,5g.
2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)aniline (CAS 685853-98-9) is a chemical compound with the molecular formula C12H16F3N3 and a molecular weight of 259.27 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)aniline. InChIKey: COSZABZQSFPDEA-UHFFFAOYSA-N.
| Molecular formula | C12H16F3N3 |
|---|---|
| Molecular weight | 259.27 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)aniline |
| InChIKey | COSZABZQSFPDEA-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)