CAS 68592-11-0 appears in our catalog under these names: Chlortalidone Impurity 6, Chlortalidone Impurity 16, 2-Chloro-5-(1-chloro-1,3-dihydro-3-oxo-1-isobenzofuranyl)-benzenesulfonyl Chloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
2-chloro-5-(1-chloro-3-oxo-2-benzofuran-1-yl)benzenesulfonyl chloride (CAS 68592-11-0) is a chemical compound with the molecular formula C14H7Cl3O4S and a molecular weight of 377.6 g/mol. IUPAC name: 2-chloro-5-(1-chloro-3-oxo-2-benzofuran-1-yl)benzenesulfonyl chloride. InChIKey: OGMWYNNFMITDOO-UHFFFAOYSA-N.
| Molecular formula | C14H7Cl3O4S |
|---|---|
| Molecular weight | 377.6 g/mol |
| IUPAC name | 2-chloro-5-(1-chloro-3-oxo-2-benzofuran-1-yl)benzenesulfonyl chloride |
| InChIKey | OGMWYNNFMITDOO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC2(C3=CC(=C(C=C3)Cl)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)