CAS 68592-12-1 appears in our catalog under these names: Chlortalidone Impurity 5, 2-(4-Chloro-3-(chlorosulfonyl)benzoyl)-benzoic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg, 5g.
2-(4-chloro-3-chlorosulfonylbenzoyl)benzoic acid (CAS 68592-12-1) is a chemical compound with the molecular formula C14H8Cl2O5S and a molecular weight of 359.2 g/mol. IUPAC name: 2-(4-chloro-3-chlorosulfonylbenzoyl)benzoic acid. InChIKey: PYSORILUZXWKON-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl2O5S |
|---|---|
| Molecular weight | 359.2 g/mol |
| IUPAC name | 2-(4-chloro-3-chlorosulfonylbenzoyl)benzoic acid |
| InChIKey | PYSORILUZXWKON-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)