CAS 68594-15-0 appears in our catalog under these names: 2,7–Dimethoxy–6–(1–acetoxyethyl)juglone, 2,7-Dimethoxy-6-(1-acetoxyethyl)juglone. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 500μg, 5mg, 10mg, 25mg, 50mg, Get quote.
1-(1-hydroxy-3,6-dimethoxy-5,8-dioxonaphthalen-2-yl)ethyl acetate (CAS 68594-15-0) is a chemical compound with the molecular formula C16H16O7 and a molecular weight of 320.29 g/mol. IUPAC name: 1-(1-hydroxy-3,6-dimethoxy-5,8-dioxonaphthalen-2-yl)ethyl acetate. InChIKey: SNIIQTSBSNAYGY-UHFFFAOYSA-N.
| Molecular formula | C16H16O7 |
|---|---|
| Molecular weight | 320.29 g/mol |
| IUPAC name | 1-(1-hydroxy-3,6-dimethoxy-5,8-dioxonaphthalen-2-yl)ethyl acetate |
| InChIKey | SNIIQTSBSNAYGY-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C2C(=C1O)C(=O)C=C(C2=O)OC)OC)OC(=O)C |
Computed by PubChem (NCBI)