CAS 6860-47-5 appears in our catalog under these names: Xylobiose, 1,4-D-Xylobiose, 98%, Xylobiose, >95% (HPLC), XYLOBIOSE/ 99.84% (existing batch purity), 1,4-D-Xylobiose. Offered by: GLPBio, Combi-blocks, TRC, TargetMol, Biosynth. Available pack sizes: 5mg, 100mg, 250mg, 1g, 10mg, 2mg, 25mg, 50mg.
(2R,3R,4R)-2,3,5-trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentanal (CAS 6860-47-5) is a chemical compound with the molecular formula C10H18O9 and a molecular weight of 282.24 g/mol. IUPAC name: (2R,3R,4R)-2,3,5-trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentanal. InChIKey: SQNRKWHRVIAKLP-RSZZQXBVSA-N.
| Molecular formula | C10H18O9 |
|---|---|
| Molecular weight | 282.24 g/mol |
| IUPAC name | (2R,3R,4R)-2,3,5-trihydroxy-4-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxypentanal |
| InChIKey | SQNRKWHRVIAKLP-RSZZQXBVSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@H](CO)[C@@H]([C@H](C=O)O)O)O)O)O |
Computed by PubChem (NCBI)