CAS 68620-10-0 is the registry number for (2E)-3-(2,4-Dichlorophenyl)-2-phenylacrylonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-3-(2,4-dichlorophenyl)-2-phenylprop-2-enenitrile (CAS 68620-10-0) is a chemical compound with the molecular formula C15H9Cl2N and a molecular weight of 274.1 g/mol. IUPAC name: (E)-3-(2,4-dichlorophenyl)-2-phenylprop-2-enenitrile. InChIKey: KMPHRQRSPYKVJB-JYRVWZFOSA-N.
| Molecular formula | C15H9Cl2N |
|---|---|
| Molecular weight | 274.1 g/mol |
| IUPAC name | (E)-3-(2,4-dichlorophenyl)-2-phenylprop-2-enenitrile |
| InChIKey | KMPHRQRSPYKVJB-JYRVWZFOSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C\C2=C(C=C(C=C2)Cl)Cl)/C#N |
Computed by PubChem (NCBI)