Products 68622-07-1

CAS 68622-07-1 is the registry number for 3-Fluorophenyl chloroformate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(3-fluorophenyl) carbonochloridate (CAS 68622-07-1) is a chemical compound with the molecular formula C7H4ClFO2 and a molecular weight of 174.55 g/mol. IUPAC name: (3-fluorophenyl) carbonochloridate. InChIKey: UIEYPDNYJMIKMW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClFO2
Molecular weight174.55 g/mol
IUPAC name(3-fluorophenyl) carbonochloridate
InChIKeyUIEYPDNYJMIKMW-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)F)OC(=O)Cl

Computed by PubChem (NCBI)