Products 686344-29-6
CAS 686344-29-6 appears in our catalog under these names: Otenabant/ 100%, Otenabant, 1-[8-(2-Chlorophenyl)-9-(4-chlorophenyl)-9H-purin-6-yl]-4-(ethylamino)-4-piperidinecarboxamide, 99%, 99%, Otenabant, 99.23%, Otenabant, 99%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 50 mg.
1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-(ethylamino)piperidine-4-carboxamide (CAS 686344-29-6) is a chemical compound with the molecular formula C25H25Cl2N7O and a molecular weight of 510.4 g/mol. IUPAC name: 1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-(ethylamino)piperidine-4-carboxamide. InChIKey: UNAZAADNBYXMIV-UHFFFAOYSA-N.
| Molecular formula | C25H25Cl2N7O |
|---|---|
| Molecular weight | 510.4 g/mol |
| IUPAC name | 1-[8-(2-chlorophenyl)-9-(4-chlorophenyl)purin-6-yl]-4-(ethylamino)piperidine-4-carboxamide |
| InChIKey | UNAZAADNBYXMIV-UHFFFAOYSA-N |
| SMILES | CCNC1(CCN(CC1)C2=NC=NC3=C2N=C(N3C4=CC=C(C=C4)Cl)C5=CC=CC=C5Cl)C(=O)N |
Computed by PubChem (NCBI)