CAS 68639-26-9 is the registry number for (E)-N'-(3,5-Dibromo-2-hydroxybenzylidene)nicotinohydrazide. Offered by: TRC. Available pack sizes: 100mg.
N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]pyridine-3-carboxamide (CAS 68639-26-9) is a chemical compound with the molecular formula C13H9Br2N3O2 and a molecular weight of 399.04 g/mol. IUPAC name: N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]pyridine-3-carboxamide. InChIKey: OJJMOQAFMPSKRU-REZTVBANSA-N.
| Molecular formula | C13H9Br2N3O2 |
|---|---|
| Molecular weight | 399.04 g/mol |
| IUPAC name | N-[(E)-(3,5-dibromo-2-hydroxyphenyl)methylideneamino]pyridine-3-carboxamide |
| InChIKey | OJJMOQAFMPSKRU-REZTVBANSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)N/N=C/C2=C(C(=CC(=C2)Br)Br)O |
Computed by PubChem (NCBI)