CAS 686743-57-7 is the registry number for 3-((4-Fluorobenzyl)sulfonyl)-1-methyl-1H-indole, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
3-[(4-fluorophenyl)methylsulfonyl]-1-methylindole (CAS 686743-57-7) is a chemical compound with the molecular formula C16H14FNO2S and a molecular weight of 303.4 g/mol. IUPAC name: 3-[(4-fluorophenyl)methylsulfonyl]-1-methylindole. InChIKey: CSWOTBQXBLETIE-UHFFFAOYSA-N.
| Molecular formula | C16H14FNO2S |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | 3-[(4-fluorophenyl)methylsulfonyl]-1-methylindole |
| InChIKey | CSWOTBQXBLETIE-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)S(=O)(=O)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)