CAS 68686-42-0 is the registry number for (Z)-N,N-Dimethyl-1-(methylthio)-2-nitroethen-1-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-N,N-dimethyl-1-methylsulfanyl-2-nitroethenamine (CAS 68686-42-0) is a chemical compound with the molecular formula C5H10N2O2S and a molecular weight of 162.21 g/mol. IUPAC name: (Z)-N,N-dimethyl-1-methylsulfanyl-2-nitroethenamine. InChIKey: HUDRYGJMGVJMCD-PLNGDYQASA-N.
| Molecular formula | C5H10N2O2S |
|---|---|
| Molecular weight | 162.21 g/mol |
| IUPAC name | (Z)-N,N-dimethyl-1-methylsulfanyl-2-nitroethenamine |
| InChIKey | HUDRYGJMGVJMCD-PLNGDYQASA-N |
| SMILES | CN(C)/C(=C/[N+](=O)[O-])/SC |
Computed by PubChem (NCBI)