Products 6872-53-3
CAS 6872-53-3 is the registry number for Norscopine. Offered by: TRC. Available pack sizes: 25mg.
(1R,2R,4S,5S)-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol (CAS 6872-53-3) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. IUPAC name: (1R,2R,4S,5S)-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol. InChIKey: IVFBZLRQSYYTCB-JMTYFUNVSA-N.
| Molecular formula | C7H11NO2 |
|---|---|
| Molecular weight | 141.17 g/mol |
| IUPAC name | (1R,2R,4S,5S)-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-ol |
| InChIKey | IVFBZLRQSYYTCB-JMTYFUNVSA-N |
| SMILES | C1[C@@H]2[C@@H]3[C@@H](O3)[C@@H](N2)CC1O |
Computed by PubChem (NCBI)
Synonyms:
Norscopine, Tiotropium Bromide Impurity 17