CAS 68726-28-3 appears in our catalog under these names: 2',3'-DIDEOXYGUANOSINE 5'-TRIPHOSPHATE S, 2`,3`-Dideoxy-guanosine 5`-(Tetrahydrogen Triphosphate), ddGTP, 2',3'-Dideoxyguanosine-5'-triphosphate lithium salt - 100mM aqueous solution, 2,3-Dideoxyguanosine-5-triphosphate, 99.5%, 99.5%. Offered by: Sigma-Aldrich, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 2MG, 25mg, 1mg, 2,5mg, 10mg, 5mg, 20mg.
[[(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (CAS 68726-28-3) is a chemical compound with the molecular formula C10H16N5O12P3 and a molecular weight of 491.18 g/mol. IUPAC name: [[(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate. InChIKey: HDRRAMINWIWTNU-PRJDIBJQSA-N.
| Molecular formula | C10H16N5O12P3 |
|---|---|
| Molecular weight | 491.18 g/mol |
| IUPAC name | [[(5R)-5-(2-amino-6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChIKey | HDRRAMINWIWTNU-PRJDIBJQSA-N |
| SMILES | C1CC(O[C@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
Computed by PubChem (NCBI)