CAS 68738-10-3 is the registry number for 5-endo-Hydroxyborneol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,2S,4R,5S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,5-diol (CAS 68738-10-3) is a chemical compound with the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. IUPAC name: (1R,2S,4R,5S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,5-diol. InChIKey: HLVIHBJQDKVEAL-GHCJXIJMSA-N.
| Molecular formula | C10H18O2 |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | (1R,2S,4R,5S)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,5-diol |
| InChIKey | HLVIHBJQDKVEAL-GHCJXIJMSA-N |
| SMILES | C[C@@]12C[C@@H]([C@@H](C1(C)C)C[C@@H]2O)O |
Computed by PubChem (NCBI)