Products 68739-90-2

CAS 68739-90-2 is the registry number for (S)-Benzyl 2-amino-4-(methylthio)butanoate 4-methylbenzenesulfonate, 97%(HPLC),RG, 97%(HPLC),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl (2S)-2-amino-4-methylsulfanylbutanoate;4-methylbenzenesulfonic acid (CAS 68739-90-2) is a chemical compound with the molecular formula C19H25NO5S2 and a molecular weight of 411.5 g/mol. IUPAC name: benzyl (2S)-2-amino-4-methylsulfanylbutanoate;4-methylbenzenesulfonic acid. InChIKey: HVNFDGNZVKCCTM-MERQFXBCSA-N.

Identity
Molecular formulaC19H25NO5S2
Molecular weight411.5 g/mol
IUPAC namebenzyl (2S)-2-amino-4-methylsulfanylbutanoate;4-methylbenzenesulfonic acid
InChIKeyHVNFDGNZVKCCTM-MERQFXBCSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)O.CSCC[C@@H](C(=O)OCC1=CC=CC=C1)N

Computed by PubChem (NCBI)