CAS 68739-90-2 is the registry number for (S)-Benzyl 2-amino-4-(methylthio)butanoate 4-methylbenzenesulfonate, 97%(HPLC),RG, 97%(HPLC),RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Benzyl (2S)-2-amino-4-methylsulfanylbutanoate;4-methylbenzenesulfonic acid (CAS 68739-90-2) is a chemical compound with the molecular formula C19H25NO5S2 and a molecular weight of 411.5 g/mol. IUPAC name: benzyl (2S)-2-amino-4-methylsulfanylbutanoate;4-methylbenzenesulfonic acid. InChIKey: HVNFDGNZVKCCTM-MERQFXBCSA-N.
| Molecular formula | C19H25NO5S2 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | benzyl (2S)-2-amino-4-methylsulfanylbutanoate;4-methylbenzenesulfonic acid |
| InChIKey | HVNFDGNZVKCCTM-MERQFXBCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CSCC[C@@H](C(=O)OCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)