CAS 6876-34-2 appears in our catalog under these names: 2,4,6–Tris(4–cyanophenyl)–1,3,5–triazine, 4,4',4''-(1,3,5-Triazine-2,4,6-triyl)tribenzonitrile, 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
4-[4,6-bis(4-cyanophenyl)-1,3,5-triazin-2-yl]benzonitrile (CAS 6876-34-2) is a chemical compound with the molecular formula C24H12N6 and a molecular weight of 384.4 g/mol. IUPAC name: 4-[4,6-bis(4-cyanophenyl)-1,3,5-triazin-2-yl]benzonitrile. InChIKey: ZYKRIYCYWOHUDV-UHFFFAOYSA-N.
| Molecular formula | C24H12N6 |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | 4-[4,6-bis(4-cyanophenyl)-1,3,5-triazin-2-yl]benzonitrile |
| InChIKey | ZYKRIYCYWOHUDV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=NC(=NC(=N2)C3=CC=C(C=C3)C#N)C4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)