CAS 6880-23-5 is the registry number for Magnesium Fumarate. Offered by: TRC. Available pack sizes: 10g.
Magnesium (E)-but-2-enedioate (CAS 6880-23-5) is a chemical compound with the molecular formula C4H2MgO4 and a molecular weight of 138.36 g/mol. IUPAC name: magnesium (E)-but-2-enedioate. InChIKey: QUIOHQITLKCGNW-TYYBGVCCSA-L.
| Molecular formula | C4H2MgO4 |
|---|---|
| Molecular weight | 138.36 g/mol |
| IUPAC name | magnesium (E)-but-2-enedioate |
| InChIKey | QUIOHQITLKCGNW-TYYBGVCCSA-L |
| SMILES | C(=C/C(=O)[O-])\C(=O)[O-].[Mg+2] |
Computed by PubChem (NCBI)