CAS 68800-30-6 is the registry number for L-Phenylalanine, L-phenylalanyl-, hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoic acid;hydrochloride (CAS 68800-30-6) is a chemical compound with the molecular formula C18H21ClN2O3 and a molecular weight of 348.8 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoic acid;hydrochloride. InChIKey: HMGVAZYOKLTFSH-MOGJOVFKSA-N.
| Molecular formula | C18H21ClN2O3 |
|---|---|
| Molecular weight | 348.8 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoic acid;hydrochloride |
| InChIKey | HMGVAZYOKLTFSH-MOGJOVFKSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O)N.Cl |
Computed by PubChem (NCBI)