CAS 68801-24-1 is the registry number for 4-(Bromomethyl)benzylidene Camphor. Offered by: TRC. Available pack sizes: 2,5g.
(1S,3Z,4R)-3-[[4-(bromomethyl)phenyl]methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (CAS 68801-24-1) is a chemical compound with the molecular formula C18H21BrO and a molecular weight of 333.3 g/mol. IUPAC name: (1S,3Z,4R)-3-[[4-(bromomethyl)phenyl]methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one. InChIKey: DTEBTFVOIHNTBU-ZLTRSOCKSA-N.
| Molecular formula | C18H21BrO |
|---|---|
| Molecular weight | 333.3 g/mol |
| IUPAC name | (1S,3Z,4R)-3-[[4-(bromomethyl)phenyl]methylidene]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| InChIKey | DTEBTFVOIHNTBU-ZLTRSOCKSA-N |
| SMILES | C[C@]12CC[C@H](C1(C)C)/C(=C/C3=CC=C(C=C3)CBr)/C2=O |
Computed by PubChem (NCBI)