Products 68820-81-5
CAS 68820-81-5 is the registry number for ethyl 1-[(S)-1-phenylethyl]aziridine-(S)-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl (2S)-1-[(1S)-1-phenylethyl]aziridine-2-carboxylate (CAS 68820-81-5) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: ethyl (2S)-1-[(1S)-1-phenylethyl]aziridine-2-carboxylate. InChIKey: KBVVVXBUYQUXAD-RJXBTYEGSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | ethyl (2S)-1-[(1S)-1-phenylethyl]aziridine-2-carboxylate |
| InChIKey | KBVVVXBUYQUXAD-RJXBTYEGSA-N |
| SMILES | CCOC(=O)[C@@H]1CN1[C@@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)