CAS 68833-93-2 is the registry number for 1H-Indol-7-amine hydrochloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1H-indol-7-amine;hydrochloride (CAS 68833-93-2) is a chemical compound with the molecular formula C8H9ClN2 and a molecular weight of 168.62 g/mol. IUPAC name: 1H-indol-7-amine;hydrochloride. InChIKey: HFYGNSUGNRRQFF-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2 |
|---|---|
| Molecular weight | 168.62 g/mol |
| IUPAC name | 1H-indol-7-amine;hydrochloride |
| InChIKey | HFYGNSUGNRRQFF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)NC=C2.Cl |
Computed by PubChem (NCBI)