CAS 688763-64-6 appears in our catalog under these names: Elubrixin, 98%, Elubrixin/ 98.65% (existing batch purity), 1-(4-Chloro-2-hydroxy-3-(piperazin-1-ylsulfonyl)phenyl)-3-(2-chloro-3-fluorophenyl)urea, 98%, 98%, Elubrixin. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 50mg, 1mg, 5mg, 10mg, 25mg, 500mg, 50 mg.
1-(2-chloro-3-fluorophenyl)-3-(4-chloro-2-hydroxy-3-piperazin-1-ylsulfonylphenyl)urea (CAS 688763-64-6) is a chemical compound with the molecular formula C17H17Cl2FN4O4S and a molecular weight of 463.3 g/mol. IUPAC name: 1-(2-chloro-3-fluorophenyl)-3-(4-chloro-2-hydroxy-3-piperazin-1-ylsulfonylphenyl)urea. InChIKey: YQYFEGTYCUQBEI-UHFFFAOYSA-N.
| Molecular formula | C17H17Cl2FN4O4S |
|---|---|
| Molecular weight | 463.3 g/mol |
| IUPAC name | 1-(2-chloro-3-fluorophenyl)-3-(4-chloro-2-hydroxy-3-piperazin-1-ylsulfonylphenyl)urea |
| InChIKey | YQYFEGTYCUQBEI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=C(C=CC(=C2O)NC(=O)NC3=C(C(=CC=C3)F)Cl)Cl |
Computed by PubChem (NCBI)