CAS 688790-78-5 is the registry number for 2-Butyne-1,4-diol-(1,1,4,4)-d4. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1,1,4,4-tetradeuteriobut-2-yne-1,4-diol (CAS 688790-78-5) is a chemical compound with the molecular formula C4H6O2 and a molecular weight of 90.11 g/mol. IUPAC name: 1,1,4,4-tetradeuteriobut-2-yne-1,4-diol. InChIKey: DLDJFQGPPSQZKI-KHORGVISSA-N.
| Molecular formula | C4H6O2 |
|---|---|
| Molecular weight | 90.11 g/mol |
| IUPAC name | 1,1,4,4-tetradeuteriobut-2-yne-1,4-diol |
| InChIKey | DLDJFQGPPSQZKI-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C#CC([2H])([2H])O)O |
Computed by PubChem (NCBI)