CAS 6891-44-7 appears in our catalog under these names: 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium methyl sulfate, 97%, 2–(Methacryloyloxy)–N,N,N–trimethylethanaminium methylsulfate, 2-(Methacryloyloxy)-N,N,N-trimethylethanaminium Methyl Sulfate, >98.0%(T), Methacryloyloxyethyltrimethylammonium methyl sulfate, 98%, 98%. Offered by: AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 25g, 5g.
Methyl sulfate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (CAS 6891-44-7) is a chemical compound with the molecular formula C10H21NO6S and a molecular weight of 283.34 g/mol. IUPAC name: methyl sulfate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium. InChIKey: IHBKAGRPNRKYAO-UHFFFAOYSA-M.
| Molecular formula | C10H21NO6S |
|---|---|
| Molecular weight | 283.34 g/mol |
| IUPAC name | methyl sulfate;trimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| InChIKey | IHBKAGRPNRKYAO-UHFFFAOYSA-M |
| SMILES | CC(=C)C(=O)OCC[N+](C)(C)C.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)